C7H17N3O — CID 89352923
1-ethoxy-3,5-dimethyl-1,3,5-triazinane (PubChem CID 89352923) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-ethoxy-3,5-dimethyl-1,3,5-triazinane.
| Compound Name | 1-ethoxy-3,5-dimethyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 89352923 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 1-ethoxy-3,5-dimethyl-1,3,5-triazinane |
| SMILES | CCON1CN(C)CN(C)C1 |
| InChI | InChI=1S/C7H17N3O/c1-4-11-10-6-8(2)5-9(3)7-10/h4-7H2,1-3H3 |
| InChIKey | YUYSRZBERVMLOL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |