C10H22N2O2 — CID 175823545
1,4-diethoxy-2-ethylpiperazine (PubChem CID 175823545) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,4-diethoxy-2-ethylpiperazine.
| Compound Name | 1,4-diethoxy-2-ethylpiperazine |
|---|---|
| PubChem CID | 175823545 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1,4-diethoxy-2-ethylpiperazine |
| SMILES | CCON1CCN(OCC)C(CC)C1 |
| InChI | InChI=1S/C10H22N2O2/c1-4-10-9-11(13-5-2)7-8-12(10)14-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | KLMWFIJCUQPMDA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |