C11H20N2O5 — CID 175298941
bis(3-ethoxy-1,3-oxazolidin-2-yl)methanone (PubChem CID 175298941) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is bis(3-ethoxy-1,3-oxazolidin-2-yl)methanone.
| Compound Name | bis(3-ethoxy-1,3-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 175298941 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | bis(3-ethoxy-1,3-oxazolidin-2-yl)methanone |
| SMILES | CCON1CCOC1C(=O)C1OCCN1OCC |
| InChI | InChI=1S/C11H20N2O5/c1-3-17-12-5-7-15-10(12)9(14)11-13(18-4-2)6-8-16-11/h10-11H,3-8H2,1-2H3 |
| InChIKey | JHJBTMIXVCNEHB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |