C8H15NO2 — CID 45088515
2-(1-ethoxyethenyl)-3-methyl-1,3-oxazolidine (PubChem CID 45088515) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-(1-ethoxyethenyl)-3-methyl-1,3-oxazolidine.
| Compound Name | 2-(1-ethoxyethenyl)-3-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 45088515 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-(1-ethoxyethenyl)-3-methyl-1,3-oxazolidine |
| SMILES | C=C(OCC)C1OCCN1C |
| InChI | InChI=1S/C8H15NO2/c1-4-10-7(2)8-9(3)5-6-11-8/h8H,2,4-6H2,1,3H3 |
| InChIKey | WHODDMYGFPQOGP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|