C13H21NO5 — CID 89336056
methyl 6-(1-ethoxyethenyl)-1,4-dioxa-9-azaspiro[4.5]decane-9-carboxylate (PubChem CID 89336056) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is methyl 6-(1-ethoxyethenyl)-1,4-dioxa-9-azaspiro[4.5]decane-9-carboxylate.
| Compound Name | methyl 6-(1-ethoxyethenyl)-1,4-dioxa-9-azaspiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 89336056 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | methyl 6-(1-ethoxyethenyl)-1,4-dioxa-9-azaspiro[4.5]decane-9-carboxylate |
| SMILES | C=C(OCC)C1CCN(C(=O)OC)CC12OCCO2 |
| InChI | InChI=1S/C13H21NO5/c1-4-17-10(2)11-5-6-14(12(15)16-3)9-13(11)18-7-8-19-13/h11H,2,4-9H2,1,3H3 |
| InChIKey | HTQALRYNLXXIJS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|