C10H17NO6 — CID 124637348
(4S)-3,3-dimethoxy-1-methoxycarbonylpiperidine-4-carboxylic acid (PubChem CID 124637348) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is (4S)-3,3-dimethoxy-1-methoxycarbonylpiperidine-4-carboxylic acid.
| Compound Name | (4S)-3,3-dimethoxy-1-methoxycarbonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 124637348 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (4S)-3,3-dimethoxy-1-methoxycarbonylpiperidine-4-carboxylic acid |
| SMILES | COC(=O)N1CC[C@H](C(=O)O)C(OC)(OC)C1 |
| InChI | InChI=1S/C10H17NO6/c1-15-9(14)11-5-4-7(8(12)13)10(6-11,16-2)17-3/h7H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | YJKVMGXIFJVOMH-SSDOTTSWSA-N |
| XLogP | 0.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|