About 3,5-dimethyl-1,3,5-triazinan-1-amine
3,5-dimethyl-1,3,5-triazinan-1-amine (PubChem CID 141002820) has the molecular formula C5H14N4
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-triazinan-1-amine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3,5-triazinan-1-amine |
| PubChem CID | 141002820 |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 3,5-dimethyl-1,3,5-triazinan-1-amine |
| SMILES | CN1CN(C)CN(N)C1 |
| InChI | InChI=1S/C5H14N4/c1-7-3-8(2)5-9(6)4-7/h3-6H2,1-2H3 |
| InChIKey | NZNAHPNLSZKNPS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,3,5-triazinan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3,5-triazinan-1-amine?
The IUPAC name of 3,5-dimethyl-1,3,5-triazinan-1-amine (CID 141002820) is 3,5-dimethyl-1,3,5-triazinan-1-amine.
What is the SMILES notation for 3,5-dimethyl-1,3,5-triazinan-1-amine?
The canonical SMILES for 3,5-dimethyl-1,3,5-triazinan-1-amine is CN1CN(C)CN(N)C1.
What is the InChIKey of 3,5-dimethyl-1,3,5-triazinan-1-amine?
The InChIKey is NZNAHPNLSZKNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4/c1-7-3-8(2)5-9(6)4-7/h3-6H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,3,5-triazinan-1-amine?
3,5-dimethyl-1,3,5-triazinan-1-amine has a molecular weight of 130.19 g/mol, XLogP of -1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3,5-triazinan-1-amine is sourced from PubChem (CID 141002820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).