C36H72N12 — CID 126584438
1,3,5-tris[4-(3,5-dimethyl-1,3,5-triazinan-1-yl)cyclohexyl]-1,3,5-triazinane (PubChem CID 126584438) has the molecular formula C36H72N12 and a molecular weight of 673.06 g/mol. Its IUPAC name is 1,3,5-tris[4-(3,5-dimethyl-1,3,5-triazinan-1-yl)cyclohexyl]-1,3,5-triazinane.
| Compound Name | 1,3,5-tris[4-(3,5-dimethyl-1,3,5-triazinan-1-yl)cyclohexyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 126584438 |
| Molecular Formula | C36H72N12 |
| Molecular Weight | 673.06 g/mol |
| Exact Mass | 672.60 |
| IUPAC Name | 1,3,5-tris[4-(3,5-dimethyl-1,3,5-triazinan-1-yl)cyclohexyl]-1,3,5-triazinane |
| SMILES | CN1CN(C)CN(C2CCC(N3CN(C4CCC(N5CN(C)CN(C)C5)CC4)CN(C4CCC(N5CN(C)CN(C)C5)CC4)C3)CC2)C1 |
| InChI | InChI=1S/C36H72N12/c1-37-19-38(2)23-43(22-37)31-7-13-34(14-8-31)46-28-47(35-15-9-32(10-16-35)44-24-39(3)20-40(4)25-44)30-48(29-46)36-17-11-33(12-18-36)45-26-41(5)21-42(6)27-45/h31-36H,7-30H2,1-6H3 |
| InChIKey | POXIUPPEUUADDJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.06 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |