About 3-methyl-1,3,5-triazinan-1-amine
3-methyl-1,3,5-triazinan-1-amine (PubChem CID 144981078) has the molecular formula C4H12N4
and a molecular weight of 116.17 g/mol. Its IUPAC name is 3-methyl-1,3,5-triazinan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-1,3,5-triazinan-1-amine |
| PubChem CID | 144981078 |
| Molecular Formula | C4H12N4 |
| Molecular Weight | 116.17 g/mol |
| Exact Mass | 116.11 |
| IUPAC Name | 3-methyl-1,3,5-triazinan-1-amine |
| SMILES | CN1CNCN(N)C1 |
| InChI | InChI=1S/C4H12N4/c1-7-2-6-3-8(5)4-7/h6H,2-5H2,1H3 |
| InChIKey | GNJXRJYYJZGCNB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.17 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,3,5-triazinan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3,5-triazinan-1-amine?
The IUPAC name of 3-methyl-1,3,5-triazinan-1-amine (CID 144981078) is 3-methyl-1,3,5-triazinan-1-amine.
What is the SMILES notation for 3-methyl-1,3,5-triazinan-1-amine?
The canonical SMILES for 3-methyl-1,3,5-triazinan-1-amine is CN1CNCN(N)C1.
What is the InChIKey of 3-methyl-1,3,5-triazinan-1-amine?
The InChIKey is GNJXRJYYJZGCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N4/c1-7-2-6-3-8(5)4-7/h6H,2-5H2,1H3.
What are the key properties of 3-methyl-1,3,5-triazinan-1-amine?
3-methyl-1,3,5-triazinan-1-amine has a molecular weight of 116.17 g/mol, XLogP of -1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3,5-triazinan-1-amine is sourced from PubChem (CID 144981078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).