C4H12N4 — CID 144981078
3-methyl-1,3,5-triazinan-1-amine (PubChem CID 144981078) has the molecular formula C4H12N4 and a molecular weight of 116.17 g/mol. Its IUPAC name is 3-methyl-1,3,5-triazinan-1-amine.
| Compound Name | 3-methyl-1,3,5-triazinan-1-amine |
|---|---|
| PubChem CID | 144981078 |
| Molecular Formula | C4H12N4 |
| Molecular Weight | 116.17 g/mol |
| Exact Mass | 116.11 |
| IUPAC Name | 3-methyl-1,3,5-triazinan-1-amine |
| SMILES | CN1CNCN(N)C1 |
| InChI | InChI=1S/C4H12N4/c1-7-2-6-3-8(5)4-7/h6H,2-5H2,1H3 |
| InChIKey | GNJXRJYYJZGCNB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.17 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|