About 1-amino-1,3-diazinan-5-ol
1-amino-1,3-diazinan-5-ol (PubChem CID 146411797) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-amino-1,3-diazinan-5-ol.
Molecular Properties
| Compound Name | 1-amino-1,3-diazinan-5-ol |
| PubChem CID | 146411797 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 1-amino-1,3-diazinan-5-ol |
| SMILES | NN1CNCC(O)C1 |
| InChI | InChI=1S/C4H11N3O/c5-7-2-4(8)1-6-3-7/h4,6,8H,1-3,5H2 |
| InChIKey | IMGKQGBXWSMJMB-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1,3-diazinan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1,3-diazinan-5-ol?
The IUPAC name of 1-amino-1,3-diazinan-5-ol (CID 146411797) is 1-amino-1,3-diazinan-5-ol.
What is the SMILES notation for 1-amino-1,3-diazinan-5-ol?
The canonical SMILES for 1-amino-1,3-diazinan-5-ol is NN1CNCC(O)C1.
What is the InChIKey of 1-amino-1,3-diazinan-5-ol?
The InChIKey is IMGKQGBXWSMJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c5-7-2-4(8)1-6-3-7/h4,6,8H,1-3,5H2.
What are the key properties of 1-amino-1,3-diazinan-5-ol?
1-amino-1,3-diazinan-5-ol has a molecular weight of 117.15 g/mol, XLogP of -1.92, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1,3-diazinan-5-ol is sourced from PubChem (CID 146411797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).