C4H11N3O — CID 146411797
1-amino-1,3-diazinan-5-ol (PubChem CID 146411797) has the molecular formula C4H11N3O and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-amino-1,3-diazinan-5-ol.
| Compound Name | 1-amino-1,3-diazinan-5-ol |
|---|---|
| PubChem CID | 146411797 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 1-amino-1,3-diazinan-5-ol |
| SMILES | NN1CNCC(O)C1 |
| InChI | InChI=1S/C4H11N3O/c5-7-2-4(8)1-6-3-7/h4,6,8H,1-3,5H2 |
| InChIKey | IMGKQGBXWSMJMB-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|