C6H14N2O2 — CID 144890831
1-aminoazepane-3,6-diol (PubChem CID 144890831) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-aminoazepane-3,6-diol.
| Compound Name | 1-aminoazepane-3,6-diol |
|---|---|
| PubChem CID | 144890831 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-aminoazepane-3,6-diol |
| SMILES | NN1CC(O)CCC(O)C1 |
| InChI | InChI=1S/C6H14N2O2/c7-8-3-5(9)1-2-6(10)4-8/h5-6,9-10H,1-4,7H2 |
| InChIKey | YMDRHDRXQVXHPI-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|