C6H14N2O — CID 134534794
(3S,5S)-1-amino-5-methylpiperidin-3-ol (PubChem CID 134534794) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is (3S,5S)-1-amino-5-methylpiperidin-3-ol.
| Compound Name | (3S,5S)-1-amino-5-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 134534794 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (3S,5S)-1-amino-5-methylpiperidin-3-ol |
| SMILES | C[C@H]1C[C@H](O)CN(N)C1 |
| InChI | InChI=1S/C6H14N2O/c1-5-2-6(9)4-8(7)3-5/h5-6,9H,2-4,7H2,1H3/t5-,6-/m0/s1 |
| InChIKey | CDJQYBZSPIUDEV-WDSKDSINSA-N |
| XLogP | -0.44 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|