About azetidin-3-ol;butanedioic acid
azetidin-3-ol;butanedioic acid (PubChem CID 175438233) has the molecular formula C7H13NO5
and a molecular weight of 191.18 g/mol. Its IUPAC name is azetidin-3-ol;butanedioic acid.
Molecular Properties
| Compound Name | azetidin-3-ol;butanedioic acid |
| PubChem CID | 175438233 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | azetidin-3-ol;butanedioic acid |
| SMILES | O=C(O)CCC(=O)O.OC1CNC1 |
| InChI | InChI=1S/C4H6O4.C3H7NO/c5-3(6)1-2-4(7)8;5-3-1-4-2-3/h1-2H2,(H,5,6)(H,7,8);3-5H,1-2H2 |
| InChIKey | BXJQKHGXTOQZBQ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azetidin-3-ol;butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-ol;butanedioic acid?
The IUPAC name of azetidin-3-ol;butanedioic acid (CID 175438233) is azetidin-3-ol;butanedioic acid.
What is the SMILES notation for azetidin-3-ol;butanedioic acid?
The canonical SMILES for azetidin-3-ol;butanedioic acid is O=C(O)CCC(=O)O.OC1CNC1.
What is the InChIKey of azetidin-3-ol;butanedioic acid?
The InChIKey is BXJQKHGXTOQZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.C3H7NO/c5-3(6)1-2-4(7)8;5-3-1-4-2-3/h1-2H2,(H,5,6)(H,7,8);3-5H,1-2H2.
What are the key properties of azetidin-3-ol;butanedioic acid?
azetidin-3-ol;butanedioic acid has a molecular weight of 191.18 g/mol, XLogP of -1.11, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-ol;butanedioic acid is sourced from PubChem (CID 175438233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).