C5H15N5 — CID 59906329
1,5-dimethyl-1,2,4,5,7-pentazocane (PubChem CID 59906329) has the molecular formula C5H15N5 and a molecular weight of 145.21 g/mol. Its IUPAC name is 1,5-dimethyl-1,2,4,5,7-pentazocane.
| Compound Name | 1,5-dimethyl-1,2,4,5,7-pentazocane |
|---|---|
| PubChem CID | 59906329 |
| Molecular Formula | C5H15N5 |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 1,5-dimethyl-1,2,4,5,7-pentazocane |
| SMILES | CN1CNCN(C)NCN1 |
| InChI | InChI=1S/C5H15N5/c1-9-4-6-5-10(2)8-3-7-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | FNVQNTUJYQTRPA-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |