C6H15N3 — CID 21323958
1-propan-2-yl-1,3,5-triazinane (PubChem CID 21323958) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1-propan-2-yl-1,3,5-triazinane.
| Compound Name | 1-propan-2-yl-1,3,5-triazinane |
|---|---|
| PubChem CID | 21323958 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1-propan-2-yl-1,3,5-triazinane |
| SMILES | CC(C)N1CNCNC1 |
| InChI | InChI=1S/C6H15N3/c1-6(2)9-4-7-3-8-5-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | GTJCTYKPIIIPKH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |