C9H21N3 — CID 155613866
1,3-di(propan-2-yl)-1,3,5-triazinane (PubChem CID 155613866) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)-1,3,5-triazinane.
| Compound Name | 1,3-di(propan-2-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 155613866 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1,3-di(propan-2-yl)-1,3,5-triazinane |
| SMILES | CC(C)N1CNCN(C(C)C)C1 |
| InChI | InChI=1S/C9H21N3/c1-8(2)11-5-10-6-12(7-11)9(3)4/h8-10H,5-7H2,1-4H3 |
| InChIKey | RYIRXYGZBIYEKY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |