C10H23N3 — CID 15402375
1-methyl-3,5-di(propan-2-yl)-1,3,5-triazinane (PubChem CID 15402375) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-methyl-3,5-di(propan-2-yl)-1,3,5-triazinane.
| Compound Name | 1-methyl-3,5-di(propan-2-yl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 15402375 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-methyl-3,5-di(propan-2-yl)-1,3,5-triazinane |
| SMILES | CC(C)N1CN(C)CN(C(C)C)C1 |
| InChI | InChI=1S/C10H23N3/c1-9(2)12-6-11(5)7-13(8-12)10(3)4/h9-10H,6-8H2,1-5H3 |
| InChIKey | DYDBRJXCQXOQRZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |