C7H19N3 — CID 123525370
ethane;1,2,4-trimethyl-1,2,4-triazolidine (PubChem CID 123525370) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is ethane;1,2,4-trimethyl-1,2,4-triazolidine.
| Compound Name | ethane;1,2,4-trimethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 123525370 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | ethane;1,2,4-trimethyl-1,2,4-triazolidine |
| SMILES | CC.CN1CN(C)N(C)C1 |
| InChI | InChI=1S/C5H13N3.C2H6/c1-6-4-7(2)8(3)5-6;1-2/h4-5H2,1-3H3;1-2H3 |
| InChIKey | RXSVLVKBOJDNET-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |