C8H20N4 — CID 146939924
1,3-diethyl-1,3,5,7-tetrazocane (PubChem CID 146939924) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is 1,3-diethyl-1,3,5,7-tetrazocane.
| Compound Name | 1,3-diethyl-1,3,5,7-tetrazocane |
|---|---|
| PubChem CID | 146939924 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 1,3-diethyl-1,3,5,7-tetrazocane |
| SMILES | CCN1CNCNCN(CC)C1 |
| InChI | InChI=1S/C8H20N4/c1-3-11-6-9-5-10-7-12(4-2)8-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | AGRBACLYBFDISX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |