C9H22N3+ — CID 174488604
hydron;1,3,5-triethyl-1,3,5-triazinane (PubChem CID 174488604) has the molecular formula C9H22N3+ and a molecular weight of 172.30 g/mol. Its IUPAC name is hydron;1,3,5-triethyl-1,3,5-triazinane.
| Compound Name | hydron;1,3,5-triethyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 174488604 |
| Molecular Formula | C9H22N3+ |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | hydron;1,3,5-triethyl-1,3,5-triazinane |
| SMILES | CCN1CN(CC)CN(CC)C1.[H+] |
| InChI | InChI=1S/C9H21N3/c1-4-10-7-11(5-2)9-12(6-3)8-10/h4-9H2,1-3H3/p+1 |
| InChIKey | XYRTVIAPRQLSOW-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |