About carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium
carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium (PubChem CID 59967719) has the molecular formula C6H14N2Y-2
and a molecular weight of 203.10 g/mol. Its IUPAC name is carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium.
Molecular Properties
| Compound Name | carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium |
| PubChem CID | 59967719 |
| Molecular Formula | C6H14N2Y-2 |
| Molecular Weight | 203.10 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium |
| SMILES | [CH2-]N1CN(CC)C1.[CH3-].[Y] |
| InChI | InChI=1S/C5H11N2.CH3.Y/c1-3-7-4-6(2)5-7;;/h2-5H2,1H3;1H3;/q2*-1; |
| InChIKey | JKPVSWGDRKRSIZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.10 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium?
The IUPAC name of carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium (CID 59967719) is carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium.
What is the SMILES notation for carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium?
The canonical SMILES for carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium is [CH2-]N1CN(CC)C1.[CH3-].[Y].
What is the InChIKey of carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium?
The InChIKey is JKPVSWGDRKRSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2.CH3.Y/c1-3-7-4-6(2)5-7;;/h2-5H2,1H3;1H3;/q2*-1;.
What are the key properties of carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium?
carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium has a molecular weight of 203.10 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-ethyl-3-methanidyl-1,3-diazetidine;yttrium is sourced from PubChem (CID 59967719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).