About 1-ethyl-1,3,5-triazinan-2-ol
1-ethyl-1,3,5-triazinan-2-ol (PubChem CID 174816614) has the molecular formula C5H13N3O
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-ethyl-1,3,5-triazinan-2-ol.
Molecular Properties
| Compound Name | 1-ethyl-1,3,5-triazinan-2-ol |
| PubChem CID | 174816614 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 1-ethyl-1,3,5-triazinan-2-ol |
| SMILES | CCN1CNCNC1O |
| InChI | InChI=1S/C5H13N3O/c1-2-8-4-6-3-7-5(8)9/h5-7,9H,2-4H2,1H3 |
| InChIKey | OFSXYLDCJZDCNL-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-1,3,5-triazinan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,3,5-triazinan-2-ol?
The IUPAC name of 1-ethyl-1,3,5-triazinan-2-ol (CID 174816614) is 1-ethyl-1,3,5-triazinan-2-ol.
What is the SMILES notation for 1-ethyl-1,3,5-triazinan-2-ol?
The canonical SMILES for 1-ethyl-1,3,5-triazinan-2-ol is CCN1CNCNC1O.
What is the InChIKey of 1-ethyl-1,3,5-triazinan-2-ol?
The InChIKey is OFSXYLDCJZDCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O/c1-2-8-4-6-3-7-5(8)9/h5-7,9H,2-4H2,1H3.
What are the key properties of 1-ethyl-1,3,5-triazinan-2-ol?
1-ethyl-1,3,5-triazinan-2-ol has a molecular weight of 131.18 g/mol, XLogP of -1.31, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,3,5-triazinan-2-ol is sourced from PubChem (CID 174816614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).