C9H20N2 — CID 12634508
1,3-diethyl-2-methyl-1,3-diazinane (PubChem CID 12634508) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,3-diethyl-2-methyl-1,3-diazinane.
| Compound Name | 1,3-diethyl-2-methyl-1,3-diazinane |
|---|---|
| PubChem CID | 12634508 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,3-diethyl-2-methyl-1,3-diazinane |
| SMILES | CCN1CCCN(CC)C1C |
| InChI | InChI=1S/C9H20N2/c1-4-10-7-6-8-11(5-2)9(10)3/h9H,4-8H2,1-3H3 |
| InChIKey | VLUQSQIDSZAISP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |