C6H14N2 — CID 153319077
2,2,3,3,5,5,6,6-octadeuterio-1-ethylpiperazine (PubChem CID 153319077) has the molecular formula C6H14N2 and a molecular weight of 122.24 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octadeuterio-1-ethylpiperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octadeuterio-1-ethylpiperazine |
|---|---|
| PubChem CID | 153319077 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 122.24 g/mol |
| Exact Mass | 122.17 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-1-ethylpiperazine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(CC)C1([2H])[2H] |
| InChI | InChI=1S/C6H14N2/c1-2-8-5-3-7-4-6-8/h7H,2-6H2,1H3/i3D2,4D2,5D2,6D2 |
| InChIKey | WGCYRFWNGRMRJA-SQUIKQQTSA-N |
| XLogP | -0.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |