C12H26N8 — CID 102333919
3-methyl-7-(1,3,5,7-tetrazabicyclo[3.3.1]nonan-3-ylmethyl)-1,3,5,7-tetrazabicyclo[3.3.1]nonane (PubChem CID 102333919) has the molecular formula C12H26N8 and a molecular weight of 282.40 g/mol. Its IUPAC name is 3-methyl-7-(1,3,5,7-tetrazabicyclo[3.3.1]nonan-3-ylmethyl)-1,3,5,7-tetrazabicyclo[3.3.1]nonane.
| Compound Name | 3-methyl-7-(1,3,5,7-tetrazabicyclo[3.3.1]nonan-3-ylmethyl)-1,3,5,7-tetrazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102333919 |
| Molecular Formula | C12H26N8 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-methyl-7-(1,3,5,7-tetrazabicyclo[3.3.1]nonan-3-ylmethyl)-1,3,5,7-tetrazabicyclo[3.3.1]nonane |
| SMILES | CN1CN2CN(C1)CN(CN1CN3CNCN(C3)C1)C2 |
| InChI | InChI=1S/C12H26N8/c1-14-4-17-9-18(5-14)11-20(10-17)12-19-7-15-2-13-3-16(6-15)8-19/h13H,2-12H2,1H3 |
| InChIKey | MRRDYMBUPQQSNK-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 34.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |