About 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane
3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane (PubChem CID 163612698) has the molecular formula C6H15N4+
and a molecular weight of 143.21 g/mol. Its IUPAC name is 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane.
Analyze 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane?
The IUPAC name of 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane (CID 163612698) is 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane.
What is the SMILES notation for 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane?
The canonical SMILES for 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane is CN1CN2CNC[NH+](C1)C2.
What is the InChIKey of 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane?
The InChIKey is HHHNMAVFJQFVGB-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H14N4/c1-8-4-9-2-7-3-10(5-8)6-9/h7H,2-6H2,1H3/p+1.
What are the key properties of 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane?
3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane has a molecular weight of 143.21 g/mol, XLogP of -2.49, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,5,7-triaza-1-azoniabicyclo[3.3.1]nonane is sourced from PubChem (CID 163612698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).