About 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane
1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane (PubChem CID 166883484) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane.
Analyze 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane?
The IUPAC name of 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane (CID 166883484) is 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane.
What is the SMILES notation for 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane?
The canonical SMILES for 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane is CN1CCN(CN2CCCNC2)C1.
What is the InChIKey of 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane?
The InChIKey is WIKQFDPDHJBXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4/c1-11-5-6-13(8-11)9-12-4-2-3-10-7-12/h10H,2-9H2,1H3.
What are the key properties of 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane?
1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane has a molecular weight of 184.29 g/mol, XLogP of -0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methylimidazolidin-1-yl)methyl]-1,3-diazinane is sourced from PubChem (CID 166883484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).