C12H26N4 — CID 67024959
1-[4-(1,3-diazinan-2-yl)butyl]-1,3-diazinane (PubChem CID 67024959) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1-[4-(1,3-diazinan-2-yl)butyl]-1,3-diazinane.
| Compound Name | 1-[4-(1,3-diazinan-2-yl)butyl]-1,3-diazinane |
|---|---|
| PubChem CID | 67024959 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 1-[4-(1,3-diazinan-2-yl)butyl]-1,3-diazinane |
| SMILES | C1CNC(CCCCN2CCCNC2)NC1 |
| InChI | InChI=1S/C12H26N4/c1(5-12-14-7-3-8-15-12)2-9-16-10-4-6-13-11-16/h12-15H,1-11H2 |
| InChIKey | FZXVHONJIFFKAE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|