About 1-ethyl-3-methylimidazolidine;phosphane;bromide
1-ethyl-3-methylimidazolidine;phosphane;bromide (PubChem CID 167699735) has the molecular formula C6H17BrN2P-
and a molecular weight of 228.09 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazolidine;phosphane;bromide.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazolidine;phosphane;bromide |
| PubChem CID | 167699735 |
| Molecular Formula | C6H17BrN2P- |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-ethyl-3-methylimidazolidine;phosphane;bromide |
| SMILES | CCN1CCN(C)C1.P.[Br-] |
| InChI | InChI=1S/C6H14N2.BrH.H3P/c1-3-8-5-4-7(2)6-8;;/h3-6H2,1-2H3;1H;1H3/p-1 |
| InChIKey | HAKUDMXNWSUVHD-UHFFFAOYSA-M |
| XLogP | -2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazolidine;phosphane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazolidine;phosphane;bromide?
The IUPAC name of 1-ethyl-3-methylimidazolidine;phosphane;bromide (CID 167699735) is 1-ethyl-3-methylimidazolidine;phosphane;bromide.
What is the SMILES notation for 1-ethyl-3-methylimidazolidine;phosphane;bromide?
The canonical SMILES for 1-ethyl-3-methylimidazolidine;phosphane;bromide is CCN1CCN(C)C1.P.[Br-].
What is the InChIKey of 1-ethyl-3-methylimidazolidine;phosphane;bromide?
The InChIKey is HAKUDMXNWSUVHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14N2.BrH.H3P/c1-3-8-5-4-7(2)6-8;;/h3-6H2,1-2H3;1H;1H3/p-1.
What are the key properties of 1-ethyl-3-methylimidazolidine;phosphane;bromide?
1-ethyl-3-methylimidazolidine;phosphane;bromide has a molecular weight of 228.09 g/mol, XLogP of -2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazolidine;phosphane;bromide is sourced from PubChem (CID 167699735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).