acetic acid;1-ethyl-3-methylimidazolidine

C8H18N2O2 — CID 162317080

IUPACacetic acid;1-ethyl-3-methylimidazolidine
SMILESCC(=O)O.CCN1CCN(C)C1
InChIInChI=1S/C6H14N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4)
InChIKeyQEQHWBGIIQQMLO-UHFFFAOYSA-N
MW174.24 g/mol
LogP0.30
Rot. Bonds1

About acetic acid;1-ethyl-3-methylimidazolidine

acetic acid;1-ethyl-3-methylimidazolidine (PubChem CID 162317080) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is acetic acid;1-ethyl-3-methylimidazolidine.

Molecular Properties

Compound Nameacetic acid;1-ethyl-3-methylimidazolidine
PubChem CID162317080
Molecular FormulaC8H18N2O2
Molecular Weight174.24 g/mol
Exact Mass174.14
IUPAC Nameacetic acid;1-ethyl-3-methylimidazolidine
SMILESCC(=O)O.CCN1CCN(C)C1
InChIInChI=1S/C6H14N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4)
InChIKeyQEQHWBGIIQQMLO-UHFFFAOYSA-N
XLogP0.30
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;1-ethyl-3-methylimidazolidine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1-ethyl-3-methylimidazolidine?
The IUPAC name of acetic acid;1-ethyl-3-methylimidazolidine (CID 162317080) is acetic acid;1-ethyl-3-methylimidazolidine.
What is the SMILES notation for acetic acid;1-ethyl-3-methylimidazolidine?
The canonical SMILES for acetic acid;1-ethyl-3-methylimidazolidine is CC(=O)O.CCN1CCN(C)C1.
What is the InChIKey of acetic acid;1-ethyl-3-methylimidazolidine?
The InChIKey is QEQHWBGIIQQMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C2H4O2/c1-3-8-5-4-7(2)6-8;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-ethyl-3-methylimidazolidine?
acetic acid;1-ethyl-3-methylimidazolidine has a molecular weight of 174.24 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-ethyl-3-methylimidazolidine is sourced from PubChem (CID 162317080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).