C7H16N2 — CID 54539532
1-butyl-3-methyl-1,3-diazetidine (PubChem CID 54539532) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-butyl-3-methyl-1,3-diazetidine.
| Compound Name | 1-butyl-3-methyl-1,3-diazetidine |
|---|---|
| PubChem CID | 54539532 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-butyl-3-methyl-1,3-diazetidine |
| SMILES | CCCCN1CN(C)C1 |
| InChI | InChI=1S/C7H16N2/c1-3-4-5-9-6-8(2)7-9/h3-7H2,1-2H3 |
| InChIKey | ZCDZJXYKJLFLSL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |