About 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride
1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride (PubChem CID 158364955) has the molecular formula C9H20F6N2P-
and a molecular weight of 301.24 g/mol. Its IUPAC name is 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride.
Molecular Properties
| Compound Name | 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride |
| PubChem CID | 158364955 |
| Molecular Formula | C9H20F6N2P- |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride |
| SMILES | CCCCCN1CCN(C)C1.FP(F)(F)(F)F.[F-] |
| InChI | InChI=1S/C9H20N2.F5P.FH/c1-3-4-5-6-11-8-7-10(2)9-11;1-6(2,3,4)5;/h3-9H2,1-2H3;;1H/p-1 |
| InChIKey | GTXPALBRHLURHK-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride?
The IUPAC name of 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride (CID 158364955) is 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride.
What is the SMILES notation for 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride?
The canonical SMILES for 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride is CCCCCN1CCN(C)C1.FP(F)(F)(F)F.[F-].
What is the InChIKey of 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride?
The InChIKey is GTXPALBRHLURHK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H20N2.F5P.FH/c1-3-4-5-6-11-8-7-10(2)9-11;1-6(2,3,4)5;/h3-9H2,1-2H3;;1H/p-1.
What are the key properties of 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride?
1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride has a molecular weight of 301.24 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-pentylimidazolidine;pentafluoro-λ5-phosphane;fluoride is sourced from PubChem (CID 158364955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).