C17H35N3 — CID 19832453
1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane (PubChem CID 19832453) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane.
| Compound Name | 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 19832453 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane |
| SMILES | CCCCN1CN(CCCC)CN(C2CCCCC2)C1 |
| InChI | InChI=1S/C17H35N3/c1-3-5-12-18-14-19(13-6-4-2)16-20(15-18)17-10-8-7-9-11-17/h17H,3-16H2,1-2H3 |
| InChIKey | JPLNGDWCNKKOTJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |