C17H33N3S — CID 14070321
1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 14070321) has the molecular formula C17H33N3S and a molecular weight of 311.54 g/mol. Its IUPAC name is 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane-2-thione.
| Compound Name | 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 14070321 |
| Molecular Formula | C17H33N3S |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 1,3-dibutyl-5-cyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | CCCCN1CN(C2CCCCC2)CN(CCCC)C1=S |
| InChI | InChI=1S/C17H33N3S/c1-3-5-12-18-14-20(16-10-8-7-9-11-16)15-19(17(18)21)13-6-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | LHYOKVMEELWNNT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|