C21H45N3O3 — CID 142761173
1,3,5-tris(2-butoxyethyl)-1,3,5-triazinane (PubChem CID 142761173) has the molecular formula C21H45N3O3 and a molecular weight of 387.61 g/mol. Its IUPAC name is 1,3,5-tris(2-butoxyethyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(2-butoxyethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 142761173 |
| Molecular Formula | C21H45N3O3 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.35 |
| IUPAC Name | 1,3,5-tris(2-butoxyethyl)-1,3,5-triazinane |
| SMILES | CCCCOCCN1CN(CCOCCCC)CN(CCOCCCC)C1 |
| InChI | InChI=1S/C21H45N3O3/c1-4-7-13-25-16-10-22-19-23(11-17-26-14-8-5-2)21-24(20-22)12-18-27-15-9-6-3/h4-21H2,1-3H3 |
| InChIKey | PDIQXSRDIHQZFV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|