C36H75N3O3 — CID 22661655
1,3,5-tris[3-(3-ethylhexoxy)propyl]-1,3,5-triazinane (PubChem CID 22661655) has the molecular formula C36H75N3O3 and a molecular weight of 598.01 g/mol. Its IUPAC name is 1,3,5-tris[3-(3-ethylhexoxy)propyl]-1,3,5-triazinane.
| Compound Name | 1,3,5-tris[3-(3-ethylhexoxy)propyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 22661655 |
| Molecular Formula | C36H75N3O3 |
| Molecular Weight | 598.01 g/mol |
| Exact Mass | 597.58 |
| IUPAC Name | 1,3,5-tris[3-(3-ethylhexoxy)propyl]-1,3,5-triazinane |
| SMILES | CCCC(CC)CCOCCCN1CN(CCCOCCC(CC)CCC)CN(CCCOCCC(CC)CCC)C1 |
| InChI | InChI=1S/C36H75N3O3/c1-7-16-34(10-4)19-28-40-25-13-22-37-31-38(23-14-26-41-29-20-35(11-5)17-8-2)33-39(32-37)24-15-27-42-30-21-36(12-6)18-9-3/h34-36H,7-33H2,1-6H3 |
| InChIKey | HVZLFUMGDDUBJA-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.01 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|