C16H34O3 — CID 58572257
1,5-dipropoxy-3-(2-propoxyethyl)pentane (PubChem CID 58572257) has the molecular formula C16H34O3 and a molecular weight of 274.44 g/mol. Its IUPAC name is 1,5-dipropoxy-3-(2-propoxyethyl)pentane.
| Compound Name | 1,5-dipropoxy-3-(2-propoxyethyl)pentane |
|---|---|
| PubChem CID | 58572257 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 1,5-dipropoxy-3-(2-propoxyethyl)pentane |
| SMILES | CCCOCCC(CCOCCC)CCOCCC |
| InChI | InChI=1S/C16H34O3/c1-4-10-17-13-7-16(8-14-18-11-5-2)9-15-19-12-6-3/h16H,4-15H2,1-3H3 |
| InChIKey | NEJPURXQSNJLMW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|