About 3-ethoxy-1-propoxybutane
3-ethoxy-1-propoxybutane (PubChem CID 89015567) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-ethoxy-1-propoxybutane.
Molecular Properties
| Compound Name | 3-ethoxy-1-propoxybutane |
| PubChem CID | 89015567 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 3-ethoxy-1-propoxybutane |
| SMILES | CCCOCCC(C)OCC |
| InChI | InChI=1S/C9H20O2/c1-4-7-10-8-6-9(3)11-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | OKLLFDGZXPPGCQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-1-propoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1-propoxybutane?
The IUPAC name of 3-ethoxy-1-propoxybutane (CID 89015567) is 3-ethoxy-1-propoxybutane.
What is the SMILES notation for 3-ethoxy-1-propoxybutane?
The canonical SMILES for 3-ethoxy-1-propoxybutane is CCCOCCC(C)OCC.
What is the InChIKey of 3-ethoxy-1-propoxybutane?
The InChIKey is OKLLFDGZXPPGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-4-7-10-8-6-9(3)11-5-2/h9H,4-8H2,1-3H3.
What are the key properties of 3-ethoxy-1-propoxybutane?
3-ethoxy-1-propoxybutane has a molecular weight of 160.26 g/mol, XLogP of 2.23, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1-propoxybutane is sourced from PubChem (CID 89015567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).