C13H25N — CID 67672486
2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 67672486) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 67672486 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | CCCCN1CCC2CCCCC2C1 |
| InChI | InChI=1S/C13H25N/c1-2-3-9-14-10-8-12-6-4-5-7-13(12)11-14/h12-13H,2-11H2,1H3 |
| InChIKey | YSWIKUISTPOPSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |