C14H25NO — CID 143073916
5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]pentan-2-one (PubChem CID 143073916) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]pentan-2-one.
| Compound Name | 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 143073916 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]pentan-2-one |
| SMILES | CC(=O)CCCN1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C14H25NO/c1-12(16)5-4-9-15-10-8-13-6-2-3-7-14(13)11-15/h13-14H,2-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | YWAFNEDCTLCSJX-UONOGXRCSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |