C20H38N2O2 — CID 143073846
5-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)pentan-2-one;N-tert-butylformamide (PubChem CID 143073846) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 5-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)pentan-2-one;N-tert-butylformamide.
| Compound Name | 5-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)pentan-2-one;N-tert-butylformamide |
|---|---|
| PubChem CID | 143073846 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | 5-(1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridin-2-yl)pentan-2-one;N-tert-butylformamide |
| SMILES | CC(=O)CCCN1CCC2CCCCCC2C1.CC(C)(C)NC=O |
| InChI | InChI=1S/C15H27NO.C5H11NO/c1-13(17)6-5-10-16-11-9-14-7-3-2-4-8-15(14)12-16;1-5(2,3)6-4-7/h14-15H,2-12H2,1H3;4H,1-3H3,(H,6,7) |
| InChIKey | RTNDAKPYGTVSOR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|