C15H33NO2Si — CID 173320072
2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;dimethoxysilane (PubChem CID 173320072) has the molecular formula C15H33NO2Si and a molecular weight of 287.52 g/mol. Its IUPAC name is 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;dimethoxysilane.
| Compound Name | 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;dimethoxysilane |
|---|---|
| PubChem CID | 173320072 |
| Molecular Formula | C15H33NO2Si |
| Molecular Weight | 287.52 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 2-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline;dimethoxysilane |
| SMILES | CCCCN1CCC2CCCCC2C1.CO[SiH2]OC |
| InChI | InChI=1S/C13H25N.C2H8O2Si/c1-2-3-9-14-10-8-12-6-4-5-7-13(12)11-14;1-3-5-4-2/h12-13H,2-11H2,1H3;5H2,1-2H3 |
| InChIKey | UVYIUERTFGFMQU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|