About azane;1,2-dimethylpyrrolidin-3-amine
azane;1,2-dimethylpyrrolidin-3-amine (PubChem CID 175027569) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is azane;1,2-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | azane;1,2-dimethylpyrrolidin-3-amine |
| PubChem CID | 175027569 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | azane;1,2-dimethylpyrrolidin-3-amine |
| SMILES | CC1C(N)CCN1C.N |
| InChI | InChI=1S/C6H14N2.H3N/c1-5-6(7)3-4-8(5)2;/h5-6H,3-4,7H2,1-2H3;1H3 |
| InChIKey | UKPLPDAKOMQKPC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1,2-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-dimethylpyrrolidin-3-amine?
The IUPAC name of azane;1,2-dimethylpyrrolidin-3-amine (CID 175027569) is azane;1,2-dimethylpyrrolidin-3-amine.
What is the SMILES notation for azane;1,2-dimethylpyrrolidin-3-amine?
The canonical SMILES for azane;1,2-dimethylpyrrolidin-3-amine is CC1C(N)CCN1C.N.
What is the InChIKey of azane;1,2-dimethylpyrrolidin-3-amine?
The InChIKey is UKPLPDAKOMQKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.H3N/c1-5-6(7)3-4-8(5)2;/h5-6H,3-4,7H2,1-2H3;1H3.
What are the key properties of azane;1,2-dimethylpyrrolidin-3-amine?
azane;1,2-dimethylpyrrolidin-3-amine has a molecular weight of 131.22 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 175027569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).