C7H17Cl2NO — CID 142403583
(1,2-dimethylpyrrolidin-3-yl)methanol;dihydrochloride (PubChem CID 142403583) has the molecular formula C7H17Cl2NO and a molecular weight of 202.12 g/mol. Its IUPAC name is (1,2-dimethylpyrrolidin-3-yl)methanol;dihydrochloride.
| Compound Name | (1,2-dimethylpyrrolidin-3-yl)methanol;dihydrochloride |
|---|---|
| PubChem CID | 142403583 |
| Molecular Formula | C7H17Cl2NO |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (1,2-dimethylpyrrolidin-3-yl)methanol;dihydrochloride |
| SMILES | CC1C(CO)CCN1C.Cl.Cl |
| InChI | InChI=1S/C7H15NO.2ClH/c1-6-7(5-9)3-4-8(6)2;;/h6-7,9H,3-5H2,1-2H3;2*1H |
| InChIKey | PLHFLBUDGCEQTD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |