C6H12FN — CID 167399019
(2S,3R)-3-fluoro-1,2-dimethylpyrrolidine (PubChem CID 167399019) has the molecular formula C6H12FN and a molecular weight of 117.17 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine.
| Compound Name | (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 167399019 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine |
| SMILES | C[C@H]1[C@H](F)CCN1C |
| InChI | InChI=1S/C6H12FN/c1-5-6(7)3-4-8(5)2/h5-6H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | PYDLJPXWCLIKIR-NTSWFWBYSA-N |
| XLogP | 1.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |