About (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine
(2S,3R)-3-fluoro-1,2-dimethylpyrrolidine (PubChem CID 167399019) has the molecular formula C6H12FN
and a molecular weight of 117.17 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine |
| PubChem CID | 167399019 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine |
| SMILES | C[C@H]1[C@H](F)CCN1C |
| InChI | InChI=1S/C6H12FN/c1-5-6(7)3-4-8(5)2/h5-6H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | PYDLJPXWCLIKIR-NTSWFWBYSA-N |
| XLogP | 1.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine?
The IUPAC name of (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine (CID 167399019) is (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine.
What is the SMILES notation for (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine?
The canonical SMILES for (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine is C[C@H]1[C@H](F)CCN1C.
What is the InChIKey of (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine?
The InChIKey is PYDLJPXWCLIKIR-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H12FN/c1-5-6(7)3-4-8(5)2/h5-6H,3-4H2,1-2H3/t5-,6+/m0/s1.
What are the key properties of (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine?
(2S,3R)-3-fluoro-1,2-dimethylpyrrolidine has a molecular weight of 117.17 g/mol, XLogP of 1.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-fluoro-1,2-dimethylpyrrolidine is sourced from PubChem (CID 167399019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).