C9H19N — CID 23146803
1,2,3,4-tetramethylpiperidine (PubChem CID 23146803) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpiperidine.
| Compound Name | 1,2,3,4-tetramethylpiperidine |
|---|---|
| PubChem CID | 23146803 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,2,3,4-tetramethylpiperidine |
| SMILES | CC1CCN(C)C(C)C1C |
| InChI | InChI=1S/C9H19N/c1-7-5-6-10(4)9(3)8(7)2/h7-9H,5-6H2,1-4H3 |
| InChIKey | RXKZBVILDNOMJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |