About 1,2,3,4-tetramethylpiperidine
1,2,3,4-tetramethylpiperidine (PubChem CID 23146803) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpiperidine.
Molecular Properties
| Compound Name | 1,2,3,4-tetramethylpiperidine |
| PubChem CID | 23146803 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,2,3,4-tetramethylpiperidine |
| SMILES | CC1CCN(C)C(C)C1C |
| InChI | InChI=1S/C9H19N/c1-7-5-6-10(4)9(3)8(7)2/h7-9H,5-6H2,1-4H3 |
| InChIKey | RXKZBVILDNOMJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3,4-tetramethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethylpiperidine?
The IUPAC name of 1,2,3,4-tetramethylpiperidine (CID 23146803) is 1,2,3,4-tetramethylpiperidine.
What is the SMILES notation for 1,2,3,4-tetramethylpiperidine?
The canonical SMILES for 1,2,3,4-tetramethylpiperidine is CC1CCN(C)C(C)C1C.
What is the InChIKey of 1,2,3,4-tetramethylpiperidine?
The InChIKey is RXKZBVILDNOMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-7-5-6-10(4)9(3)8(7)2/h7-9H,5-6H2,1-4H3.
What are the key properties of 1,2,3,4-tetramethylpiperidine?
1,2,3,4-tetramethylpiperidine has a molecular weight of 141.26 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethylpiperidine is sourced from PubChem (CID 23146803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).