C7H14BrN — CID 102785593
2-(bromomethyl)-1,3-dimethylpyrrolidine (PubChem CID 102785593) has the molecular formula C7H14BrN and a molecular weight of 192.10 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-dimethylpyrrolidine.
| Compound Name | 2-(bromomethyl)-1,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 102785593 |
| Molecular Formula | C7H14BrN |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-(bromomethyl)-1,3-dimethylpyrrolidine |
| SMILES | CC1CCN(C)C1CBr |
| InChI | InChI=1S/C7H14BrN/c1-6-3-4-9(2)7(6)5-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | JMKKTGGXSKEZAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|