About ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine
ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine (PubChem CID 142151943) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine |
| PubChem CID | 142151943 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine |
| SMILES | CC.CCOCC1C(C)CCN1C |
| InChI | InChI=1S/C9H19NO.C2H6/c1-4-11-7-9-8(2)5-6-10(9)3;1-2/h8-9H,4-7H2,1-3H3;1-2H3 |
| InChIKey | DRLXGGIFIBMUAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine?
The IUPAC name of ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine (CID 142151943) is ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine.
What is the SMILES notation for ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine?
The canonical SMILES for ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine is CC.CCOCC1C(C)CCN1C.
What is the InChIKey of ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine?
The InChIKey is DRLXGGIFIBMUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C2H6/c1-4-11-7-9-8(2)5-6-10(9)3;1-2/h8-9H,4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine?
ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine has a molecular weight of 187.33 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(ethoxymethyl)-1,3-dimethylpyrrolidine is sourced from PubChem (CID 142151943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).