3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid

C10H19NO3 — CID 170367841

IUPAC3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid
SMILESC[C@H]1CCN(C)[C@@H]1COCCC(=O)O
InChIInChI=1S/C10H19NO3/c1-8-3-5-11(2)9(8)7-14-6-4-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-,9+/m0/s1
InChIKeyILSQQFVXDQNPSY-DTWKUNHWSA-N
MW201.27 g/mol
LogP0.82
Rot. Bonds5

About 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid

3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid (PubChem CID 170367841) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid.

Molecular Properties

Compound Name3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid
PubChem CID170367841
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid
SMILESC[C@H]1CCN(C)[C@@H]1COCCC(=O)O
InChIInChI=1S/C10H19NO3/c1-8-3-5-11(2)9(8)7-14-6-4-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-,9+/m0/s1
InChIKeyILSQQFVXDQNPSY-DTWKUNHWSA-N
XLogP0.82
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid?
The IUPAC name of 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid (CID 170367841) is 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid.
What is the SMILES notation for 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid?
The canonical SMILES for 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid is C[C@H]1CCN(C)[C@@H]1COCCC(=O)O.
What is the InChIKey of 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid?
The InChIKey is ILSQQFVXDQNPSY-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H19NO3/c1-8-3-5-11(2)9(8)7-14-6-4-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-,9+/m0/s1.
What are the key properties of 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid?
3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid has a molecular weight of 201.27 g/mol, XLogP of 0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,3S)-1,3-dimethylpyrrolidin-2-yl]methoxy]propanoic acid is sourced from PubChem (CID 170367841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).