C8H17NO2 — CID 89143057
(2R,3S)-2-(ethoxymethyl)-1-methylpyrrolidin-3-ol (PubChem CID 89143057) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (2R,3S)-2-(ethoxymethyl)-1-methylpyrrolidin-3-ol.
| Compound Name | (2R,3S)-2-(ethoxymethyl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 89143057 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2R,3S)-2-(ethoxymethyl)-1-methylpyrrolidin-3-ol |
| SMILES | CCOC[C@@H]1[C@@H](O)CCN1C |
| InChI | InChI=1S/C8H17NO2/c1-3-11-6-7-8(10)4-5-9(7)2/h7-8,10H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | XXXFQAUCZBDOOM-SFYZADRCSA-N |
| XLogP | 0.09 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |